C24H31Cl4NO4 — CID 3112613
decyl 6-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoate (PubChem CID 3112613) has the molecular formula C24H31Cl4NO4 and a molecular weight of 539.33 g/mol. Its IUPAC name is decyl 6-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoate.
| Compound Name | decyl 6-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 3112613 |
| Molecular Formula | C24H31Cl4NO4 |
| Molecular Weight | 539.33 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | decyl 6-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)hexanoate |
| SMILES | CCCCCCCCCCOC(=O)CCCCCN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C24H31Cl4NO4/c1-2-3-4-5-6-7-8-12-15-33-16(30)13-10-9-11-14-29-23(31)17-18(24(29)32)20(26)22(28)21(27)19(17)25/h2-15H2,1H3 |
| InChIKey | SSXITTJZUBUNDN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.33 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|