About 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole
3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole (PubChem CID 3112967) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole |
| PubChem CID | 3112967 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2=NN(c3ccccc3)C(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C23H22N2O2/c1-26-20-12-8-17(9-13-20)22-16-23(18-10-14-21(27-2)15-11-18)25(24-22)19-6-4-3-5-7-19/h3-15,23H,16H2,1-2H3 |
| InChIKey | GMHBQKAVVHKCSS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole?
The IUPAC name of 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole (CID 3112967) is 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole.
What is the SMILES notation for 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole?
The canonical SMILES for 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole is COc1ccc(C2=NN(c3ccccc3)C(c3ccc(OC)cc3)C2)cc1.
What is the InChIKey of 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole?
The InChIKey is GMHBQKAVVHKCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O2/c1-26-20-12-8-17(9-13-20)22-16-23(18-10-14-21(27-2)15-11-18)25(24-22)19-6-4-3-5-7-19/h3-15,23H,16H2,1-2H3.
What are the key properties of 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole?
3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole has a molecular weight of 358.44 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-methoxyphenyl)-2-phenyl-3,4-dihydropyrazole is sourced from PubChem (CID 3112967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).