About (1,1-dioxothiolan-3-yl) methanesulfonate
(1,1-dioxothiolan-3-yl) methanesulfonate (PubChem CID 3113014) has the molecular formula C5H10O5S2
and a molecular weight of 214.26 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl) methanesulfonate.
Molecular Properties
| Compound Name | (1,1-dioxothiolan-3-yl) methanesulfonate |
| PubChem CID | 3113014 |
| Molecular Formula | C5H10O5S2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | (1,1-dioxothiolan-3-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H10O5S2/c1-11(6,7)10-5-2-3-12(8,9)4-5/h5H,2-4H2,1H3 |
| InChIKey | HLUBZBXWCUVIJT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (1,1-dioxothiolan-3-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxothiolan-3-yl) methanesulfonate?
The IUPAC name of (1,1-dioxothiolan-3-yl) methanesulfonate (CID 3113014) is (1,1-dioxothiolan-3-yl) methanesulfonate.
What is the SMILES notation for (1,1-dioxothiolan-3-yl) methanesulfonate?
The canonical SMILES for (1,1-dioxothiolan-3-yl) methanesulfonate is CS(=O)(=O)OC1CCS(=O)(=O)C1.
What is the InChIKey of (1,1-dioxothiolan-3-yl) methanesulfonate?
The InChIKey is HLUBZBXWCUVIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5S2/c1-11(6,7)10-5-2-3-12(8,9)4-5/h5H,2-4H2,1H3.
What are the key properties of (1,1-dioxothiolan-3-yl) methanesulfonate?
(1,1-dioxothiolan-3-yl) methanesulfonate has a molecular weight of 214.26 g/mol, XLogP of -0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxothiolan-3-yl) methanesulfonate is sourced from PubChem (CID 3113014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).