About 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea
3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea (PubChem CID 3113016) has the molecular formula C7H14N2O3S
and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea |
| PubChem CID | 3113016 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H14N2O3S/c1-9(2)7(10)8-6-3-4-13(11,12)5-6/h6H,3-5H2,1-2H3,(H,8,10) |
| InChIKey | CXNLWMNGJLNXLS-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea?
The IUPAC name of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea (CID 3113016) is 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea.
What is the SMILES notation for 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea?
The canonical SMILES for 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea is CN(C)C(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea?
The InChIKey is CXNLWMNGJLNXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3S/c1-9(2)7(10)8-6-3-4-13(11,12)5-6/h6H,3-5H2,1-2H3,(H,8,10).
What are the key properties of 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea?
3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea has a molecular weight of 206.27 g/mol, XLogP of -0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea is sourced from PubChem (CID 3113016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).