C20H18ClN3OS2 — CID 3113508
(5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(3,4-dimethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one (PubChem CID 3113508) has the molecular formula C20H18ClN3OS2 and a molecular weight of 415.97 g/mol. Its IUPAC name is (5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(3,4-dimethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(3,4-dimethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3113508 |
| Molecular Formula | C20H18ClN3OS2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | (5Z)-5-(5-chloro-3-methyl-1,3-benzothiazol-2-ylidene)-2-(3,4-dimethylphenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\S/C(=C3\Sc4ccc(Cl)cc4N3C)C(=O)N2C)cc1C |
| InChI | InChI=1S/C20H18ClN3OS2/c1-11-5-7-14(9-12(11)2)22-20-24(4)18(25)17(27-20)19-23(3)15-10-13(21)6-8-16(15)26-19/h5-10H,1-4H3/b19-17-,22-20- |
| InChIKey | UWMARKLOIBSEHP-MGXYOJEMSA-N |
| XLogP | 5.56 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|