C22H23BrN2O4 — CID 3113604
ethyl 5-(4-bromophenyl)-5-hydroxy-1-(4-phenylbutanoyl)-4H-pyrazole-3-carboxylate (PubChem CID 3113604) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is ethyl 5-(4-bromophenyl)-5-hydroxy-1-(4-phenylbutanoyl)-4H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-bromophenyl)-5-hydroxy-1-(4-phenylbutanoyl)-4H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 3113604 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | ethyl 5-(4-bromophenyl)-5-hydroxy-1-(4-phenylbutanoyl)-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(C(=O)CCCc2ccccc2)C(O)(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C22H23BrN2O4/c1-2-29-21(27)19-15-22(28,17-11-13-18(23)14-12-17)25(24-19)20(26)10-6-9-16-7-4-3-5-8-16/h3-5,7-8,11-14,28H,2,6,9-10,15H2,1H3 |
| InChIKey | OPHGXKKBWNRWSH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |