C19H22ClFN2O3S — CID 31138592
2-chloro-5-(diethylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-methylbenzamide (PubChem CID 31138592) has the molecular formula C19H22ClFN2O3S and a molecular weight of 412.91 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 2-chloro-5-(diethylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 31138592 |
| Molecular Formula | C19H22ClFN2O3S |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoyl)-N-[(2-fluorophenyl)methyl]-N-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)N(C)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C19H22ClFN2O3S/c1-4-23(5-2)27(25,26)15-10-11-17(20)16(12-15)19(24)22(3)13-14-8-6-7-9-18(14)21/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | PDNQOBJTQHTJRV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |