About 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid
3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (PubChem CID 3114054) has the molecular formula C24H28O4
and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| PubChem CID | 3114054 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| SMILES | CCCCCCOC(=O)C1C(c2ccccc2)C(C(=O)O)C1c1ccccc1 |
| InChI | InChI=1S/C24H28O4/c1-2-3-4-11-16-28-24(27)22-19(17-12-7-5-8-13-17)21(23(25)26)20(22)18-14-9-6-10-15-18/h5-10,12-15,19-22H,2-4,11,16H2,1H3,(H,25,26) |
| InChIKey | JBSLSZWLFYDHGN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
The IUPAC name of 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (CID 3114054) is 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
The canonical SMILES for 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid is CCCCCCOC(=O)C1C(c2ccccc2)C(C(=O)O)C1c1ccccc1.
What is the InChIKey of 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
The InChIKey is JBSLSZWLFYDHGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O4/c1-2-3-4-11-16-28-24(27)22-19(17-12-7-5-8-13-17)21(23(25)26)20(22)18-14-9-6-10-15-18/h5-10,12-15,19-22H,2-4,11,16H2,1H3,(H,25,26).
What are the key properties of 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid has a molecular weight of 380.48 g/mol, XLogP of 5.01, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 3114054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).