About 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid
3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (PubChem CID 3114056) has the molecular formula C26H32O4
and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| PubChem CID | 3114056 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| SMILES | CCCCCCCCOC(=O)C1C(c2ccccc2)C(C(=O)O)C1c1ccccc1 |
| InChI | InChI=1S/C26H32O4/c1-2-3-4-5-6-13-18-30-26(29)24-21(19-14-9-7-10-15-19)23(25(27)28)22(24)20-16-11-8-12-17-20/h7-12,14-17,21-24H,2-6,13,18H2,1H3,(H,27,28) |
| InChIKey | GGXSLJIBPXWBFG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
The IUPAC name of 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (CID 3114056) is 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
The canonical SMILES for 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid is CCCCCCCCOC(=O)C1C(c2ccccc2)C(C(=O)O)C1c1ccccc1.
What is the InChIKey of 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
The InChIKey is GGXSLJIBPXWBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O4/c1-2-3-4-5-6-13-18-30-26(29)24-21(19-14-9-7-10-15-19)23(25(27)28)22(24)20-16-11-8-12-17-20/h7-12,14-17,21-24H,2-6,13,18H2,1H3,(H,27,28).
What are the key properties of 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid?
3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid has a molecular weight of 408.54 g/mol, XLogP of 5.79, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid is sourced from PubChem (CID 3114056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).