C18H12N2O4 — CID 3114312
1-[2-(2,3-dioxoindol-1-yl)ethyl]indole-2,3-dione (PubChem CID 3114312) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is 1-[2-(2,3-dioxoindol-1-yl)ethyl]indole-2,3-dione.
| Compound Name | 1-[2-(2,3-dioxoindol-1-yl)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 3114312 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-[2-(2,3-dioxoindol-1-yl)ethyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCN2C(=O)C(=O)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C18H12N2O4/c21-15-11-5-1-3-7-13(11)19(17(15)23)9-10-20-14-8-4-2-6-12(14)16(22)18(20)24/h1-8H,9-10H2 |
| InChIKey | ZICIZFBOAQLOTF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|