About 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine
1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine (PubChem CID 3114434) has the molecular formula C19H20N4O6
and a molecular weight of 400.39 g/mol. Its IUPAC name is 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine.
Molecular Properties
| Compound Name | 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine |
| PubChem CID | 3114434 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine |
| SMILES | CCOc1ccc(/N=C(/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20N4O6/c1-2-29-18-5-3-15(4-6-18)20-19(21-7-9-28-10-8-21)14-11-16(22(24)25)13-17(12-14)23(26)27/h3-6,11-13H,2,7-10H2,1H3/b20-19- |
| InChIKey | VIJUZQJZVKCXBW-VXPUYCOJSA-N |
| XLogP | 3.31 |
| TPSA | 120.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine?
The IUPAC name of 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine (CID 3114434) is 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine.
What is the SMILES notation for 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine?
The canonical SMILES for 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine is CCOc1ccc(/N=C(/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)N2CCOCC2)cc1.
What is the InChIKey of 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine?
The InChIKey is VIJUZQJZVKCXBW-VXPUYCOJSA-N. The full InChI is InChI=1S/C19H20N4O6/c1-2-29-18-5-3-15(4-6-18)20-19(21-7-9-28-10-8-21)14-11-16(22(24)25)13-17(12-14)23(26)27/h3-6,11-13H,2,7-10H2,1H3/b20-19-.
What are the key properties of 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine?
1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine has a molecular weight of 400.39 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dinitrophenyl)-N-(4-ethoxyphenyl)-1-morpholin-4-ylmethanimine is sourced from PubChem (CID 3114434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).