C30H20Cl2N2O4 — CID 3114539
4,10-bis(3-chlorophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 3114539) has the molecular formula C30H20Cl2N2O4 and a molecular weight of 543.41 g/mol. Its IUPAC name is 4,10-bis(3-chlorophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | 4,10-bis(3-chlorophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 3114539 |
| Molecular Formula | C30H20Cl2N2O4 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 4,10-bis(3-chlorophenyl)-1-phenyl-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | O=C1C2C3C=CC(c4ccccc4)(C2C(=O)N1c1cccc(Cl)c1)C1C(=O)N(c2cccc(Cl)c2)C(=O)C31 |
| InChI | InChI=1S/C30H20Cl2N2O4/c31-17-8-4-10-19(14-17)33-26(35)22-21-12-13-30(24(22)28(33)37,16-6-2-1-3-7-16)25-23(21)27(36)34(29(25)38)20-11-5-9-18(32)15-20/h1-15,21-25H |
| InChIKey | CCBGQADYLXJOKE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|