About 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate
2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate (PubChem CID 3114805) has the molecular formula C10H15NO5S
and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate.
Molecular Properties
| Compound Name | 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate |
| PubChem CID | 3114805 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate |
| SMILES | O=S(=O)([O-])CCc1cc[n+](CC(O)CO)cc1 |
| InChI | InChI=1S/C10H15NO5S/c12-8-10(13)7-11-4-1-9(2-5-11)3-6-17(14,15)16/h1-2,4-5,10,12-13H,3,6-8H2 |
| InChIKey | JWVTWEJEOPIDMY-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate?
The IUPAC name of 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate (CID 3114805) is 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate.
What is the SMILES notation for 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate?
The canonical SMILES for 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate is O=S(=O)([O-])CCc1cc[n+](CC(O)CO)cc1.
What is the InChIKey of 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate?
The InChIKey is JWVTWEJEOPIDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5S/c12-8-10(13)7-11-4-1-9(2-5-11)3-6-17(14,15)16/h1-2,4-5,10,12-13H,3,6-8H2.
What are the key properties of 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate?
2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate has a molecular weight of 261.30 g/mol, XLogP of -1.59, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,3-dihydroxypropyl)pyridin-1-ium-4-yl]ethanesulfonate is sourced from PubChem (CID 3114805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).