C10H11N3O3 — CID 3114918
2-methyl-7-nitro-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 3114918) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-methyl-7-nitro-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | 2-methyl-7-nitro-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 3114918 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-methyl-7-nitro-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | CC1CC(=O)Nc2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C10H11N3O3/c1-6-4-10(14)12-9-5-7(13(15)16)2-3-8(9)11-6/h2-3,5-6,11H,4H2,1H3,(H,12,14) |
| InChIKey | KIXSJWROHBXXPD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|