About 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole
9-(2-chloroethoxymethyl)-3,6-diiodocarbazole (PubChem CID 3114922) has the molecular formula C15H12ClI2NO
and a molecular weight of 511.53 g/mol. Its IUPAC name is 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole.
Molecular Properties
| Compound Name | 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole |
| PubChem CID | 3114922 |
| Molecular Formula | C15H12ClI2NO |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 510.87 |
| IUPAC Name | 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole |
| SMILES | ClCCOCn1c2ccc(I)cc2c2cc(I)ccc21 |
| InChI | InChI=1S/C15H12ClI2NO/c16-5-6-20-9-19-14-3-1-10(17)7-12(14)13-8-11(18)2-4-15(13)19/h1-4,7-8H,5-6,9H2 |
| InChIKey | QOVAIBGWYSKUKK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole?
The IUPAC name of 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole (CID 3114922) is 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole.
What is the SMILES notation for 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole?
The canonical SMILES for 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole is ClCCOCn1c2ccc(I)cc2c2cc(I)ccc21.
What is the InChIKey of 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole?
The InChIKey is QOVAIBGWYSKUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClI2NO/c16-5-6-20-9-19-14-3-1-10(17)7-12(14)13-8-11(18)2-4-15(13)19/h1-4,7-8H,5-6,9H2.
What are the key properties of 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole?
9-(2-chloroethoxymethyl)-3,6-diiodocarbazole has a molecular weight of 511.53 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-chloroethoxymethyl)-3,6-diiodocarbazole is sourced from PubChem (CID 3114922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).