C14H24O2 — CID 3115171
5-methyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane (PubChem CID 3115171) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 5-methyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane.
| Compound Name | 5-methyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 3115171 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 5-methyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-dioxane |
| SMILES | CC1=CC(C)C(C2OCC(C)CO2)C(C)C1 |
| InChI | InChI=1S/C14H24O2/c1-9-5-11(3)13(12(4)6-9)14-15-7-10(2)8-16-14/h5,10-14H,6-8H2,1-4H3 |
| InChIKey | XJZBGEHYSMORGG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|