About 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate
2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate (PubChem CID 3115356) has the molecular formula C15H20Cl2N2O4
and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate.
Molecular Properties
| Compound Name | 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate |
| PubChem CID | 3115356 |
| Molecular Formula | C15H20Cl2N2O4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate |
| SMILES | CCC(COC(=O)Nc1ccc(Cl)c(Cl)c1)NC(=O)OC(C)C |
| InChI | InChI=1S/C15H20Cl2N2O4/c1-4-10(18-15(21)23-9(2)3)8-22-14(20)19-11-5-6-12(16)13(17)7-11/h5-7,9-10H,4,8H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | GYAFVFAGJZOFGN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate?
The IUPAC name of 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate (CID 3115356) is 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate.
What is the SMILES notation for 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate?
The canonical SMILES for 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate is CCC(COC(=O)Nc1ccc(Cl)c(Cl)c1)NC(=O)OC(C)C.
What is the InChIKey of 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate?
The InChIKey is GYAFVFAGJZOFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N2O4/c1-4-10(18-15(21)23-9(2)3)8-22-14(20)19-11-5-6-12(16)13(17)7-11/h5-7,9-10H,4,8H2,1-3H3,(H,18,21)(H,19,20).
What are the key properties of 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate?
2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate has a molecular weight of 363.24 g/mol, XLogP of 4.46, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propan-2-yloxycarbonylamino)butyl N-(3,4-dichlorophenyl)carbamate is sourced from PubChem (CID 3115356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).