About N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine
N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine (PubChem CID 3115374) has the molecular formula C26H29N5
and a molecular weight of 411.55 g/mol. Its IUPAC name is N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine.
Molecular Properties
| Compound Name | N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine |
| PubChem CID | 3115374 |
| Molecular Formula | C26H29N5 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine |
| SMILES | Cc1cccc(C)c1-n1nnnc1C(C)(C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29N5/c1-20-12-11-13-21(2)24(20)31-25(27-28-29-31)26(3,4)30(18-22-14-7-5-8-15-22)19-23-16-9-6-10-17-23/h5-17H,18-19H2,1-4H3 |
| InChIKey | GXSUAOYEXRRLNZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine?
The IUPAC name of N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine (CID 3115374) is N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine.
What is the SMILES notation for N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine?
The canonical SMILES for N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine is Cc1cccc(C)c1-n1nnnc1C(C)(C)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine?
The InChIKey is GXSUAOYEXRRLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N5/c1-20-12-11-13-21(2)24(20)31-25(27-28-29-31)26(3,4)30(18-22-14-7-5-8-15-22)19-23-16-9-6-10-17-23/h5-17H,18-19H2,1-4H3.
What are the key properties of N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine?
N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine has a molecular weight of 411.55 g/mol, XLogP of 5.22, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]propan-2-amine is sourced from PubChem (CID 3115374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).