C22H22N4O5 — CID 31155703
[2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 31155703) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 31155703 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1OC |
| InChI | InChI=1S/C22H22N4O5/c1-3-23-22(29)24-19(27)14-31-21(28)17-13-26(15-9-5-4-6-10-15)25-20(17)16-11-7-8-12-18(16)30-2/h4-13H,3,14H2,1-2H3,(H2,23,24,27,29) |
| InChIKey | KVXIPRQQWBUARY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |