About 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide
2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 3116122) has the molecular formula C16H13N5O2S
and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide |
| PubChem CID | 3116122 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc(N)c(C#N)cc2C#N)cc1 |
| InChI | InChI=1S/C16H13N5O2S/c1-23-13-4-2-12(3-5-13)20-14(22)9-24-16-11(8-18)6-10(7-17)15(19)21-16/h2-6H,9H2,1H3,(H2,19,21)(H,20,22) |
| InChIKey | XRXNZQSIYLFDNZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 124.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide?
The IUPAC name of 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide (CID 3116122) is 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide.
What is the SMILES notation for 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide?
The canonical SMILES for 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide is COc1ccc(NC(=O)CSc2nc(N)c(C#N)cc2C#N)cc1.
What is the InChIKey of 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide?
The InChIKey is XRXNZQSIYLFDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O2S/c1-23-13-4-2-12(3-5-13)20-14(22)9-24-16-11(8-18)6-10(7-17)15(19)21-16/h2-6H,9H2,1H3,(H2,19,21)(H,20,22).
What are the key properties of 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide?
2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide has a molecular weight of 339.38 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-3,5-dicyano-2-pyridinyl)sulfanyl]-N-(4-methoxyphenyl)acetamide is sourced from PubChem (CID 3116122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).