C20H16ClN7O3 — CID 3116177
2-N-(4-chlorophenyl)-6-N-(furan-2-ylmethyl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 3116177) has the molecular formula C20H16ClN7O3 and a molecular weight of 437.85 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-6-N-(furan-2-ylmethyl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-chlorophenyl)-6-N-(furan-2-ylmethyl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3116177 |
| Molecular Formula | C20H16ClN7O3 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-N-(4-chlorophenyl)-6-N-(furan-2-ylmethyl)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(NCc3ccco3)nc(Nc3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C20H16ClN7O3/c21-13-3-5-14(6-4-13)23-19-25-18(22-12-17-2-1-11-31-17)26-20(27-19)24-15-7-9-16(10-8-15)28(29)30/h1-11H,12H2,(H3,22,23,24,25,26,27) |
| InChIKey | JYBMEGFQNXXDKL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|