C21H17N5O2 — CID 3116179
4,6-diphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 3116179) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 4,6-diphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-diphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3116179 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4,6-diphenoxy-N-(pyridin-3-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc(Oc2nc(NCc3cccnc3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H17N5O2/c1-3-9-17(10-4-1)27-20-24-19(23-15-16-8-7-13-22-14-16)25-21(26-20)28-18-11-5-2-6-12-18/h1-14H,15H2,(H,23,24,25,26) |
| InChIKey | WENATBIEYNIYAU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |