C20H24N8O8 — CID 3116337
6-[2-[4-[2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]piperazin-1-yl]ethenyl]-1,3-dimethyl-5-nitropyrimidine-2,4-dione (PubChem CID 3116337) has the molecular formula C20H24N8O8 and a molecular weight of 504.46 g/mol. Its IUPAC name is 6-[2-[4-[2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]piperazin-1-yl]ethenyl]-1,3-dimethyl-5-nitropyrimidine-2,4-dione.
| Compound Name | 6-[2-[4-[2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]piperazin-1-yl]ethenyl]-1,3-dimethyl-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3116337 |
| Molecular Formula | C20H24N8O8 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 6-[2-[4-[2-(1,3-dimethyl-5-nitro-2,6-dioxopyrimidin-4-yl)ethenyl]piperazin-1-yl]ethenyl]-1,3-dimethyl-5-nitropyrimidine-2,4-dione |
| SMILES | Cn1c(C=CN2CCN(C=Cc3c([N+](=O)[O-])c(=O)n(C)c(=O)n3C)CC2)c([N+](=O)[O-])c(=O)n(C)c1=O |
| InChI | InChI=1S/C20H24N8O8/c1-21-13(15(27(33)34)17(29)23(3)19(21)31)5-7-25-9-11-26(12-10-25)8-6-14-16(28(35)36)18(30)24(4)20(32)22(14)2/h5-8H,9-12H2,1-4H3 |
| InChIKey | FIRNQIFTANSYKP-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 180.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|