C13H17NO4S — CID 3116437
5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3116437) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3116437 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 5-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C2NC(=O)C(C)S2)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO4S/c1-7-12(15)14-13(19-7)8-5-9(16-2)11(18-4)10(6-8)17-3/h5-7,13H,1-4H3,(H,14,15) |
| InChIKey | KWPYXFDWIAPDAQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |