C10H9BrCl2N2S — CID 3116468
5-(bromomethyl)-N-(2,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 3116468) has the molecular formula C10H9BrCl2N2S and a molecular weight of 340.07 g/mol. Its IUPAC name is 5-(bromomethyl)-N-(2,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(bromomethyl)-N-(2,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3116468 |
| Molecular Formula | C10H9BrCl2N2S |
| Molecular Weight | 340.07 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 5-(bromomethyl)-N-(2,5-dichlorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(Cl)c(NC2=NCC(CBr)S2)c1 |
| InChI | InChI=1S/C10H9BrCl2N2S/c11-4-7-5-14-10(16-7)15-9-3-6(12)1-2-8(9)13/h1-3,7H,4-5H2,(H,14,15) |
| InChIKey | HOGUNOVSEYWCSR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.07 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|