About 3,4-diamino-N,N-dimethylbenzenesulfonamide
3,4-diamino-N,N-dimethylbenzenesulfonamide (PubChem CID 3116507) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is 3,4-diamino-N,N-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3,4-diamino-N,N-dimethylbenzenesulfonamide |
| PubChem CID | 3116507 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3,4-diamino-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C8H13N3O2S/c1-11(2)14(12,13)6-3-4-7(9)8(10)5-6/h3-5H,9-10H2,1-2H3 |
| InChIKey | PNUAACMLJDDJGX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-N,N-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-N,N-dimethylbenzenesulfonamide?
The IUPAC name of 3,4-diamino-N,N-dimethylbenzenesulfonamide (CID 3116507) is 3,4-diamino-N,N-dimethylbenzenesulfonamide.
What is the SMILES notation for 3,4-diamino-N,N-dimethylbenzenesulfonamide?
The canonical SMILES for 3,4-diamino-N,N-dimethylbenzenesulfonamide is CN(C)S(=O)(=O)c1ccc(N)c(N)c1.
What is the InChIKey of 3,4-diamino-N,N-dimethylbenzenesulfonamide?
The InChIKey is PNUAACMLJDDJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-11(2)14(12,13)6-3-4-7(9)8(10)5-6/h3-5H,9-10H2,1-2H3.
What are the key properties of 3,4-diamino-N,N-dimethylbenzenesulfonamide?
3,4-diamino-N,N-dimethylbenzenesulfonamide has a molecular weight of 215.28 g/mol, XLogP of 0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-N,N-dimethylbenzenesulfonamide is sourced from PubChem (CID 3116507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).