C13H18N2O6 — CID 3116836
N'-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methoxybenzohydrazide (PubChem CID 3116836) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is N'-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methoxybenzohydrazide.
| Compound Name | N'-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 3116836 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N'-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methoxybenzohydrazide |
| SMILES | COc1cccc(C(=O)NNC2OC(CO)C(O)C2O)c1 |
| InChI | InChI=1S/C13H18N2O6/c1-20-8-4-2-3-7(5-8)12(19)14-15-13-11(18)10(17)9(6-16)21-13/h2-5,9-11,13,15-18H,6H2,1H3,(H,14,19) |
| InChIKey | IICZVACQCLOELP-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|