C16H11F2N3OS — CID 31171489
2,6-difluoro-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 31171489) has the molecular formula C16H11F2N3OS and a molecular weight of 331.35 g/mol. Its IUPAC name is 2,6-difluoro-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2,6-difluoro-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 31171489 |
| Molecular Formula | C16H11F2N3OS |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2,6-difluoro-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1nc(NC(=O)c2c(F)cccc2F)sc1-c1ccccn1 |
| InChI | InChI=1S/C16H11F2N3OS/c1-9-14(12-7-2-3-8-19-12)23-16(20-9)21-15(22)13-10(17)5-4-6-11(13)18/h2-8H,1H3,(H,20,21,22) |
| InChIKey | IXXPTUVBTDBXFE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |