C13H13NS — CID 3117152
2,4-dimethyl-2,3-dihydrothieno[3,2-c]quinoline (PubChem CID 3117152) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 2,4-dimethyl-2,3-dihydrothieno[3,2-c]quinoline.
| Compound Name | 2,4-dimethyl-2,3-dihydrothieno[3,2-c]quinoline |
|---|---|
| PubChem CID | 3117152 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2,4-dimethyl-2,3-dihydrothieno[3,2-c]quinoline |
| SMILES | Cc1nc2ccccc2c2c1CC(C)S2 |
| InChI | InChI=1S/C13H13NS/c1-8-7-11-9(2)14-12-6-4-3-5-10(12)13(11)15-8/h3-6,8H,7H2,1-2H3 |
| InChIKey | RVGBMSYNVQPMRR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |