C17H31ClN6O — CID 3117169
6-chloro-2-N-(2-morpholin-4-ylethyl)-4-N-octyl-1,3,5-triazine-2,4-diamine (PubChem CID 3117169) has the molecular formula C17H31ClN6O and a molecular weight of 370.93 g/mol. Its IUPAC name is 6-chloro-2-N-(2-morpholin-4-ylethyl)-4-N-octyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2-morpholin-4-ylethyl)-4-N-octyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3117169 |
| Molecular Formula | C17H31ClN6O |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 6-chloro-2-N-(2-morpholin-4-ylethyl)-4-N-octyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCNc1nc(Cl)nc(NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C17H31ClN6O/c1-2-3-4-5-6-7-8-19-16-21-15(18)22-17(23-16)20-9-10-24-11-13-25-14-12-24/h2-14H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | WDKCHOIBRDAFKU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|