C22H20N4O2S — CID 31171932
(E)-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 31171932) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is (E)-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 31171932 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (E)-N-(4-methyl-5-pyridin-2-yl-1,3-thiazol-2-yl)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(NC(=O)/C=C/c2ccc(N3CCCC3=O)cc2)sc1-c1ccccn1 |
| InChI | InChI=1S/C22H20N4O2S/c1-15-21(18-5-2-3-13-23-18)29-22(24-15)25-19(27)12-9-16-7-10-17(11-8-16)26-14-4-6-20(26)28/h2-3,5,7-13H,4,6,14H2,1H3,(H,24,25,27)/b12-9+ |
| InChIKey | PDHRYKBFBQFHAG-FMIVXFBMSA-N |
| XLogP | 4.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|