About 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one
2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 3117363) has the molecular formula C14H11ClN2O
and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one |
| PubChem CID | 3117363 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2cccc(Cl)c2)Nc2ccccc21 |
| InChI | InChI=1S/C14H11ClN2O/c15-10-5-3-4-9(8-10)13-16-12-7-2-1-6-11(12)14(18)17-13/h1-8,13,16H,(H,17,18) |
| InChIKey | CHTHIDWUTAJPBR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one?
The IUPAC name of 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one (CID 3117363) is 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one.
What is the SMILES notation for 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one?
The canonical SMILES for 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one is O=C1NC(c2cccc(Cl)c2)Nc2ccccc21.
What is the InChIKey of 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one?
The InChIKey is CHTHIDWUTAJPBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O/c15-10-5-3-4-9(8-10)13-16-12-7-2-1-6-11(12)14(18)17-13/h1-8,13,16H,(H,17,18).
What are the key properties of 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one?
2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one has a molecular weight of 258.71 g/mol, XLogP of 3.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-2,3-dihydro-1H-quinazolin-4-one is sourced from PubChem (CID 3117363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).