About N-ethyl-N'-(pyridin-4-ylmethyl)oxamide
N-ethyl-N'-(pyridin-4-ylmethyl)oxamide (PubChem CID 3117731) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is N-ethyl-N'-(pyridin-4-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N-ethyl-N'-(pyridin-4-ylmethyl)oxamide |
| PubChem CID | 3117731 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-ethyl-N'-(pyridin-4-ylmethyl)oxamide |
| SMILES | CCNC(=O)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C10H13N3O2/c1-2-12-9(14)10(15)13-7-8-3-5-11-6-4-8/h3-6H,2,7H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | ZKTVDLXEYGUNMS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(pyridin-4-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(pyridin-4-ylmethyl)oxamide?
The IUPAC name of N-ethyl-N'-(pyridin-4-ylmethyl)oxamide (CID 3117731) is N-ethyl-N'-(pyridin-4-ylmethyl)oxamide.
What is the SMILES notation for N-ethyl-N'-(pyridin-4-ylmethyl)oxamide?
The canonical SMILES for N-ethyl-N'-(pyridin-4-ylmethyl)oxamide is CCNC(=O)C(=O)NCc1ccncc1.
What is the InChIKey of N-ethyl-N'-(pyridin-4-ylmethyl)oxamide?
The InChIKey is ZKTVDLXEYGUNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2/c1-2-12-9(14)10(15)13-7-8-3-5-11-6-4-8/h3-6H,2,7H2,1H3,(H,12,14)(H,13,15).
What are the key properties of N-ethyl-N'-(pyridin-4-ylmethyl)oxamide?
N-ethyl-N'-(pyridin-4-ylmethyl)oxamide has a molecular weight of 207.23 g/mol, XLogP of -0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(pyridin-4-ylmethyl)oxamide is sourced from PubChem (CID 3117731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).