C23H20ClN3O3 — CID 3117899
(4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-3-nitrophenyl)methanone (PubChem CID 3117899) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is (4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-3-nitrophenyl)methanone.
| Compound Name | (4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3117899 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (4-anilino-2-methyl-3,4-dihydro-2H-quinolin-1-yl)-(4-chloro-3-nitrophenyl)methanone |
| SMILES | CC1CC(Nc2ccccc2)c2ccccc2N1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20ClN3O3/c1-15-13-20(25-17-7-3-2-4-8-17)18-9-5-6-10-21(18)26(15)23(28)16-11-12-19(24)22(14-16)27(29)30/h2-12,14-15,20,25H,13H2,1H3 |
| InChIKey | HUIHOZOTCUVPAF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|