C31H32F3NO9S3 — CID 3117936
tetraethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 3117936) has the molecular formula C31H32F3NO9S3 and a molecular weight of 715.79 g/mol. Its IUPAC name is tetraethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetraethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 3117936 |
| Molecular Formula | C31H32F3NO9S3 |
| Molecular Weight | 715.79 g/mol |
| Exact Mass | 715.12 |
| IUPAC Name | tetraethyl 5',5',8'-trimethyl-6'-(2,2,2-trifluoroacetyl)spiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)SC2(S1)C(C(=O)OCC)=C(C(=O)OCC)SC1=C2c2ccc(C)cc2N(C(=O)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C31H32F3NO9S3/c1-8-41-24(36)19-20(25(37)42-9-2)45-23-18(30(19)46-21(26(38)43-10-3)22(47-30)27(39)44-11-4)16-13-12-15(5)14-17(16)35(29(23,6)7)28(40)31(32,33)34/h12-14H,8-11H2,1-7H3 |
| InChIKey | NFADPJCFIYZXAF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.79 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|