C32H35BrN2O7 — CID 3118016
[2-(4-bromophenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanoate (PubChem CID 3118016) has the molecular formula C32H35BrN2O7 and a molecular weight of 639.54 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanoate |
|---|---|
| PubChem CID | 3118016 |
| Molecular Formula | C32H35BrN2O7 |
| Molecular Weight | 639.54 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanoate |
| SMILES | O=C(COC(=O)C(CCCCN1C(=O)C2C3CCC(C3)C2C1=O)N1C(=O)C2C3CCC(C3)C2C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H35BrN2O7/c33-21-10-8-16(9-11-21)23(36)15-42-32(41)22(35-30(39)26-19-6-7-20(14-19)27(26)31(35)40)3-1-2-12-34-28(37)24-17-4-5-18(13-17)25(24)29(34)38/h8-11,17-20,22,24-27H,1-7,12-15H2 |
| InChIKey | GKANYFALVRAENL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|