C20H22Cl2N2O4 — CID 31186118
3,5-dichloro-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 31186118) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 31186118 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3,5-dichloro-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | CCOc1ccc(NC(=O)CN(C)C(=O)c2cc(Cl)cc(Cl)c2)cc1OCC |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-4-27-17-7-6-16(11-18(17)28-5-2)23-19(25)12-24(3)20(26)13-8-14(21)10-15(22)9-13/h6-11H,4-5,12H2,1-3H3,(H,23,25) |
| InChIKey | CJDJRLOWWAWGPK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |