About ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate
ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate (PubChem CID 3118688) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate |
| PubChem CID | 3118688 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H17NO5/c1-4-19-12(15)8-14-13(16)9-5-10(17-2)7-11(6-9)18-3/h5-7H,4,8H2,1-3H3,(H,14,16) |
| InChIKey | LRLAGTZUEVMKAT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The IUPAC name of ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate (CID 3118688) is ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate.
What is the SMILES notation for ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The canonical SMILES for ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate is CCOC(=O)CNC(=O)c1cc(OC)cc(OC)c1.
What is the InChIKey of ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The InChIKey is LRLAGTZUEVMKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-4-19-12(15)8-14-13(16)9-5-10(17-2)7-11(6-9)18-3/h5-7H,4,8H2,1-3H3,(H,14,16).
What are the key properties of ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate?
ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate has a molecular weight of 267.28 g/mol, XLogP of 1.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3,5-dimethoxybenzoyl)amino]acetate is sourced from PubChem (CID 3118688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).