About N-pentan-2-ylbenzamide
N-pentan-2-ylbenzamide (PubChem CID 3118938) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is N-pentan-2-ylbenzamide.
Molecular Properties
| Compound Name | N-pentan-2-ylbenzamide |
| PubChem CID | 3118938 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-pentan-2-ylbenzamide |
| SMILES | CCCC(C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-3-7-10(2)13-12(14)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3,(H,13,14) |
| InChIKey | GQISYERWBJFNPY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-pentan-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-2-ylbenzamide?
The IUPAC name of N-pentan-2-ylbenzamide (CID 3118938) is N-pentan-2-ylbenzamide.
What is the SMILES notation for N-pentan-2-ylbenzamide?
The canonical SMILES for N-pentan-2-ylbenzamide is CCCC(C)NC(=O)c1ccccc1.
What is the InChIKey of N-pentan-2-ylbenzamide?
The InChIKey is GQISYERWBJFNPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-3-7-10(2)13-12(14)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3,(H,13,14).
What are the key properties of N-pentan-2-ylbenzamide?
N-pentan-2-ylbenzamide has a molecular weight of 191.27 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-2-ylbenzamide is sourced from PubChem (CID 3118938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).