About 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione
6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione (PubChem CID 3118970) has the molecular formula C12H18N4O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione |
| PubChem CID | 3118970 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione |
| SMILES | Cn1c(NC2CCCCC2)c(N=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H18N4O3/c1-15-10(13-8-6-4-3-5-7-8)9(14-19)11(17)16(2)12(15)18/h8,13H,3-7H2,1-2H3 |
| InChIKey | ILAGKVGQGMHJTD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione?
The IUPAC name of 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione (CID 3118970) is 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione.
What is the SMILES notation for 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione?
The canonical SMILES for 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione is Cn1c(NC2CCCCC2)c(N=O)c(=O)n(C)c1=O.
What is the InChIKey of 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione?
The InChIKey is ILAGKVGQGMHJTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3/c1-15-10(13-8-6-4-3-5-7-8)9(14-19)11(17)16(2)12(15)18/h8,13H,3-7H2,1-2H3.
What are the key properties of 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione?
6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione has a molecular weight of 266.30 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexylamino)-1,3-dimethyl-5-nitrosopyrimidine-2,4-dione is sourced from PubChem (CID 3118970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).