C19H20ClFN4O2S2 — CID 31190780
1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 31190780) has the molecular formula C19H20ClFN4O2S2 and a molecular weight of 454.98 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 31190780 |
| Molecular Formula | C19H20ClFN4O2S2 |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | COCCNc1nnc(SCC(=O)c2cc(C)n(-c3ccc(F)c(Cl)c3)c2C)s1 |
| InChI | InChI=1S/C19H20ClFN4O2S2/c1-11-8-14(12(2)25(11)13-4-5-16(21)15(20)9-13)17(26)10-28-19-24-23-18(29-19)22-6-7-27-3/h4-5,8-9H,6-7,10H2,1-3H3,(H,22,23) |
| InChIKey | GLASHBVQCXUDJB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|