About [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol
[1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol (PubChem CID 31191778) has the molecular formula C14H20N4O3S2
and a molecular weight of 356.47 g/mol. Its IUPAC name is [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol |
| PubChem CID | 31191778 |
| Molecular Formula | C14H20N4O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(n3cc(CO)nn3)CC2)c(C)s1 |
| InChI | InChI=1S/C14H20N4O3S2/c1-10-7-14(11(2)22-10)23(20,21)17-5-3-13(4-6-17)18-8-12(9-19)15-16-18/h7-8,13,19H,3-6,9H2,1-2H3 |
| InChIKey | MWKLROYIHYGJQK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol?
The IUPAC name of [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol (CID 31191778) is [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol?
The canonical SMILES for [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol is Cc1cc(S(=O)(=O)N2CCC(n3cc(CO)nn3)CC2)c(C)s1.
What is the InChIKey of [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol?
The InChIKey is MWKLROYIHYGJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O3S2/c1-10-7-14(11(2)22-10)23(20,21)17-5-3-13(4-6-17)18-8-12(9-19)15-16-18/h7-8,13,19H,3-6,9H2,1-2H3.
What are the key properties of [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol?
[1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol has a molecular weight of 356.47 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]triazol-4-yl]methanol is sourced from PubChem (CID 31191778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).