C32H32N2O7 — CID 3119401
phenacyl 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate (PubChem CID 3119401) has the molecular formula C32H32N2O7 and a molecular weight of 556.62 g/mol. Its IUPAC name is phenacyl 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate.
| Compound Name | phenacyl 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate |
|---|---|
| PubChem CID | 3119401 |
| Molecular Formula | C32H32N2O7 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | phenacyl 2,6-bis(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)hexanoate |
| SMILES | O=C(COC(=O)C(CCCCN1C(=O)C2C3C=CC(C3)C2C1=O)N1C(=O)C2C3C=CC(C3)C2C1=O)c1ccccc1 |
| InChI | InChI=1S/C32H32N2O7/c35-23(17-6-2-1-3-7-17)16-41-32(40)22(34-30(38)26-20-11-12-21(15-20)27(26)31(34)39)8-4-5-13-33-28(36)24-18-9-10-19(14-18)25(24)29(33)37/h1-3,6-7,9-12,18-22,24-27H,4-5,8,13-16H2 |
| InChIKey | DEBNVJCUUFJKGP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|