C25H26I2N2O3 — CID 3119515
3-[3-(3,6-diiodocarbazol-9-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 3119515) has the molecular formula C25H26I2N2O3 and a molecular weight of 656.30 g/mol. Its IUPAC name is 3-[3-(3,6-diiodocarbazol-9-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[3-(3,6-diiodocarbazol-9-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 3119515 |
| Molecular Formula | C25H26I2N2O3 |
| Molecular Weight | 656.30 g/mol |
| Exact Mass | 656.00 |
| IUPAC Name | 3-[3-(3,6-diiodocarbazol-9-yl)-2-hydroxypropyl]-1,8,8-trimethyl-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC12CCC(C(=O)N(CC(O)Cn3c4ccc(I)cc4c4cc(I)ccc43)C1=O)C2(C)C |
| InChI | InChI=1S/C25H26I2N2O3/c1-24(2)19-8-9-25(24,3)23(32)29(22(19)31)13-16(30)12-28-20-6-4-14(26)10-17(20)18-11-15(27)5-7-21(18)28/h4-7,10-11,16,19,30H,8-9,12-13H2,1-3H3 |
| InChIKey | SDZWZXJHLUTLKG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|