C20H20N4O5S — CID 3119711
4-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide (PubChem CID 3119711) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3119711 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 4-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(-n2c(O)c(/C=N/c3ccc(S(=O)(=O)N(C)C)cc3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H20N4O5S/c1-13-4-8-15(9-5-13)24-19(26)17(18(25)22-20(24)27)12-21-14-6-10-16(11-7-14)30(28,29)23(2)3/h4-12,26H,1-3H3,(H,22,25,27)/b21-12+ |
| InChIKey | IPEQVUPYNZCSGA-CIAFOILYSA-N |
| XLogP | 1.54 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|