C19H16ClN5O — CID 3119735
2-(3-chlorophenyl)-5-methyl-4-[(2-methyl-3H-benzimidazol-5-yl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 3119735) has the molecular formula C19H16ClN5O and a molecular weight of 365.82 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-methyl-4-[(2-methyl-3H-benzimidazol-5-yl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(3-chlorophenyl)-5-methyl-4-[(2-methyl-3H-benzimidazol-5-yl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3119735 |
| Molecular Formula | C19H16ClN5O |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-(3-chlorophenyl)-5-methyl-4-[(2-methyl-3H-benzimidazol-5-yl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1nc2ccc(/N=C/c3c(C)[nH]n(-c4cccc(Cl)c4)c3=O)cc2[nH]1 |
| InChI | InChI=1S/C19H16ClN5O/c1-11-16(19(26)25(24-11)15-5-3-4-13(20)8-15)10-21-14-6-7-17-18(9-14)23-12(2)22-17/h3-10,24H,1-2H3,(H,22,23)/b21-10+ |
| InChIKey | IZHXBSMEBIWRAC-UFFVCSGVSA-N |
| XLogP | 4.06 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|