C15H16N2O2S2 — CID 3119755
N'-(5-methylthiophene-3-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide (PubChem CID 3119755) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N'-(5-methylthiophene-3-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide.
| Compound Name | N'-(5-methylthiophene-3-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 3119755 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N'-(5-methylthiophene-3-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2csc3c2CCCC3)cs1 |
| InChI | InChI=1S/C15H16N2O2S2/c1-9-6-10(7-20-9)14(18)16-17-15(19)12-8-21-13-5-3-2-4-11(12)13/h6-8H,2-5H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | BYXDGTIPNNNWJN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|