C17H16O6S — CID 3119766
6,7-dimethoxy-3-(4-methoxyphenyl)-2,1lambda6-benzoxathiine 1,1-dioxide (PubChem CID 3119766) has the molecular formula C17H16O6S and a molecular weight of 348.38 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(4-methoxyphenyl)-2,1lambda6-benzoxathiine 1,1-dioxide.
| Compound Name | 6,7-dimethoxy-3-(4-methoxyphenyl)-2,1lambda6-benzoxathiine 1,1-dioxide |
|---|---|
| PubChem CID | 3119766 |
| Molecular Formula | C17H16O6S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6,7-dimethoxy-3-(4-methoxyphenyl)-2,1lambda6-benzoxathiine 1,1-dioxide |
| SMILES | COc1ccc(C2=Cc3cc(OC)c(OC)cc3S(=O)(=O)O2)cc1 |
| InChI | InChI=1S/C17H16O6S/c1-20-13-6-4-11(5-7-13)14-8-12-9-15(21-2)16(22-3)10-17(12)24(18,19)23-14/h4-10H,1-3H3 |
| InChIKey | NOCWFIGSVUYVJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|