C20H21N3O5S — CID 3119935
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-ethoxybenzamide (PubChem CID 3119935) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 3119935 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2onc(C)c2C)cc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-4-27-18-8-6-5-7-17(18)19(24)21-15-9-11-16(12-10-15)29(25,26)23-20-13(2)14(3)22-28-20/h5-12,23H,4H2,1-3H3,(H,21,24) |
| InChIKey | XONKGQCUNUTJQV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |