About 3-(3,4-dichlorophenyl)-1,1-dimethylurea
3-(3,4-dichlorophenyl)-1,1-dimethylurea (PubChem CID 3120) has the molecular formula C9H10Cl2N2O
and a molecular weight of 233.10 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
| PubChem CID | 3120 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) |
| InChIKey | XMTQQYYKAHVGBJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,4-dichlorophenyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-1,1-dimethylurea?
The IUPAC name of 3-(3,4-dichlorophenyl)-1,1-dimethylurea (CID 3120) is 3-(3,4-dichlorophenyl)-1,1-dimethylurea.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-1,1-dimethylurea?
The canonical SMILES for 3-(3,4-dichlorophenyl)-1,1-dimethylurea is CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-1,1-dimethylurea?
The InChIKey is XMTQQYYKAHVGBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O/c1-13(2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14).
What are the key properties of 3-(3,4-dichlorophenyl)-1,1-dimethylurea?
3-(3,4-dichlorophenyl)-1,1-dimethylurea has a molecular weight of 233.10 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-1,1-dimethylurea is sourced from PubChem (CID 3120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).